About methylidene-(4-propylcyclohexyl)-λ3-iodane
methylidene-(4-propylcyclohexyl)-λ3-iodane (PubChem CID 163994299) has the molecular formula C10H19I
and a molecular weight of 266.17 g/mol. Its IUPAC name is methylidene-(4-propylcyclohexyl)-λ3-iodane.
Molecular Properties
| Compound Name | methylidene-(4-propylcyclohexyl)-λ3-iodane |
| PubChem CID | 163994299 |
| Molecular Formula | C10H19I |
| Molecular Weight | 266.17 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | methylidene-(4-propylcyclohexyl)-λ3-iodane |
| SMILES | C=IC1CCC(CCC)CC1 |
| InChI | InChI=1S/C10H19I/c1-3-4-9-5-7-10(11-2)8-6-9/h9-10H,2-8H2,1H3 |
| InChIKey | UDIOMIUVZHTNTK-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.17 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze methylidene-(4-propylcyclohexyl)-λ3-iodane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylidene-(4-propylcyclohexyl)-λ3-iodane?
The IUPAC name of methylidene-(4-propylcyclohexyl)-λ3-iodane (CID 163994299) is methylidene-(4-propylcyclohexyl)-λ3-iodane.
What is the SMILES notation for methylidene-(4-propylcyclohexyl)-λ3-iodane?
The canonical SMILES for methylidene-(4-propylcyclohexyl)-λ3-iodane is C=IC1CCC(CCC)CC1.
What is the InChIKey of methylidene-(4-propylcyclohexyl)-λ3-iodane?
The InChIKey is UDIOMIUVZHTNTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19I/c1-3-4-9-5-7-10(11-2)8-6-9/h9-10H,2-8H2,1H3.
What are the key properties of methylidene-(4-propylcyclohexyl)-λ3-iodane?
methylidene-(4-propylcyclohexyl)-λ3-iodane has a molecular weight of 266.17 g/mol, XLogP of 3.75, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methylidene-(4-propylcyclohexyl)-λ3-iodane is sourced from PubChem (CID 163994299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).