C12H13NO — CID 163560732
8-ethyl-2-isocyanato-7-methylidenecycloocta-1,3,5-triene (PubChem CID 163560732) has the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. Its IUPAC name is 8-ethyl-2-isocyanato-7-methylidenecycloocta-1,3,5-triene.
| Compound Name | 8-ethyl-2-isocyanato-7-methylidenecycloocta-1,3,5-triene |
|---|---|
| PubChem CID | 163560732 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 8-ethyl-2-isocyanato-7-methylidenecycloocta-1,3,5-triene |
| SMILES | C=C1C=CC=CC(N=C=O)=CC1CC |
| InChI | InChI=1S/C12H13NO/c1-3-11-8-12(13-9-14)7-5-4-6-10(11)2/h4-8,11H,2-3H2,1H3 |
| InChIKey | FQZQPZNVZLTNSP-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|