C9H9NO2 — CID 174863640
2-hydroxyimino-1-(6-methylidenecyclohexa-2,4-dien-1-yl)ethanone (PubChem CID 174863640) has the molecular formula C9H9NO2 and a molecular weight of 163.18 g/mol. Its IUPAC name is 2-hydroxyimino-1-(6-methylidenecyclohexa-2,4-dien-1-yl)ethanone.
| Compound Name | 2-hydroxyimino-1-(6-methylidenecyclohexa-2,4-dien-1-yl)ethanone |
|---|---|
| PubChem CID | 174863640 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | 2-hydroxyimino-1-(6-methylidenecyclohexa-2,4-dien-1-yl)ethanone |
| SMILES | C=C1C=CC=CC1C(=O)C=NO |
| InChI | InChI=1S/C9H9NO2/c1-7-4-2-3-5-8(7)9(11)6-10-12/h2-6,8,12H,1H2 |
| InChIKey | JHKSVHRXVZUNAV-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|