C10H12O5 — CID 141034748
6-(4,4,4-trihydroxybutanoyl)cyclohexa-2,4-dien-1-one (PubChem CID 141034748) has the molecular formula C10H12O5 and a molecular weight of 212.20 g/mol. Its IUPAC name is 6-(4,4,4-trihydroxybutanoyl)cyclohexa-2,4-dien-1-one.
| Compound Name | 6-(4,4,4-trihydroxybutanoyl)cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 141034748 |
| Molecular Formula | C10H12O5 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 6-(4,4,4-trihydroxybutanoyl)cyclohexa-2,4-dien-1-one |
| SMILES | O=C1C=CC=CC1C(=O)CCC(O)(O)O |
| InChI | InChI=1S/C10H12O5/c11-8-4-2-1-3-7(8)9(12)5-6-10(13,14)15/h1-4,7,13-15H,5-6H2 |
| InChIKey | MAWRUFTWXDMEDN-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|