About N-cyclopropyl-6-methylidenecyclohexa-2,4-dien-1-amine
N-cyclopropyl-6-methylidenecyclohexa-2,4-dien-1-amine (PubChem CID 174873850) has the molecular formula C10H13N
and a molecular weight of 147.22 g/mol. Its IUPAC name is N-cyclopropyl-6-methylidenecyclohexa-2,4-dien-1-amine.
Analyze N-cyclopropyl-6-methylidenecyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-6-methylidenecyclohexa-2,4-dien-1-amine?
The IUPAC name of N-cyclopropyl-6-methylidenecyclohexa-2,4-dien-1-amine (CID 174873850) is N-cyclopropyl-6-methylidenecyclohexa-2,4-dien-1-amine.
What is the SMILES notation for N-cyclopropyl-6-methylidenecyclohexa-2,4-dien-1-amine?
The canonical SMILES for N-cyclopropyl-6-methylidenecyclohexa-2,4-dien-1-amine is C=C1C=CC=CC1NC1CC1.
What is the InChIKey of N-cyclopropyl-6-methylidenecyclohexa-2,4-dien-1-amine?
The InChIKey is YXOVAXTXARTYNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N/c1-8-4-2-3-5-10(8)11-9-6-7-9/h2-5,9-11H,1,6-7H2.
What are the key properties of N-cyclopropyl-6-methylidenecyclohexa-2,4-dien-1-amine?
N-cyclopropyl-6-methylidenecyclohexa-2,4-dien-1-amine has a molecular weight of 147.22 g/mol, XLogP of 1.79, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-6-methylidenecyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 174873850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).