About ethane;(1Z,3Z)-5-methyl-9-methylidenecyclonona-1,3-diene
ethane;(1Z,3Z)-5-methyl-9-methylidenecyclonona-1,3-diene (PubChem CID 143506465) has the molecular formula C13H22
and a molecular weight of 178.32 g/mol. Its IUPAC name is ethane;(1Z,3Z)-5-methyl-9-methylidenecyclonona-1,3-diene.
Molecular Properties
| Compound Name | ethane;(1Z,3Z)-5-methyl-9-methylidenecyclonona-1,3-diene |
| PubChem CID | 143506465 |
| Molecular Formula | C13H22 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.17 |
| IUPAC Name | ethane;(1Z,3Z)-5-methyl-9-methylidenecyclonona-1,3-diene |
| SMILES | C=C1/C=C\C=C/C(C)CCC1.CC |
| InChI | InChI=1S/C11H16.C2H6/c1-10-6-3-4-7-11(2)9-5-8-10;1-2/h3-4,6-7,11H,1,5,8-9H2,2H3;1-2H3/b6-3-,7-4-; |
| InChIKey | FEUTWZHOGQFVDA-VZQQMBJGSA-N |
| XLogP | 4.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;(1Z,3Z)-5-methyl-9-methylidenecyclonona-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(1Z,3Z)-5-methyl-9-methylidenecyclonona-1,3-diene?
The IUPAC name of ethane;(1Z,3Z)-5-methyl-9-methylidenecyclonona-1,3-diene (CID 143506465) is ethane;(1Z,3Z)-5-methyl-9-methylidenecyclonona-1,3-diene.
What is the SMILES notation for ethane;(1Z,3Z)-5-methyl-9-methylidenecyclonona-1,3-diene?
The canonical SMILES for ethane;(1Z,3Z)-5-methyl-9-methylidenecyclonona-1,3-diene is C=C1/C=C\C=C/C(C)CCC1.CC.
What is the InChIKey of ethane;(1Z,3Z)-5-methyl-9-methylidenecyclonona-1,3-diene?
The InChIKey is FEUTWZHOGQFVDA-VZQQMBJGSA-N. The full InChI is InChI=1S/C11H16.C2H6/c1-10-6-3-4-7-11(2)9-5-8-10;1-2/h3-4,6-7,11H,1,5,8-9H2,2H3;1-2H3/b6-3-,7-4-;.
What are the key properties of ethane;(1Z,3Z)-5-methyl-9-methylidenecyclonona-1,3-diene?
ethane;(1Z,3Z)-5-methyl-9-methylidenecyclonona-1,3-diene has a molecular weight of 178.32 g/mol, XLogP of 4.50, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(1Z,3Z)-5-methyl-9-methylidenecyclonona-1,3-diene is sourced from PubChem (CID 143506465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).