C16H23Ir- — CID 173143021
(1Z,3Z)-1,5-dimethylcycloocta-1,3-diene;iridium;2-methylcyclopenta-1,3-diene (PubChem CID 173143021) has the molecular formula C16H23Ir- and a molecular weight of 407.58 g/mol. Its IUPAC name is (1Z,3Z)-1,5-dimethylcycloocta-1,3-diene;iridium;2-methylcyclopenta-1,3-diene.
| Compound Name | (1Z,3Z)-1,5-dimethylcycloocta-1,3-diene;iridium;2-methylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 173143021 |
| Molecular Formula | C16H23Ir- |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | (1Z,3Z)-1,5-dimethylcycloocta-1,3-diene;iridium;2-methylcyclopenta-1,3-diene |
| SMILES | C/C1=C/C=C\C(C)CCC1.CC1=[C-]CC=C1.[Ir] |
| InChI | InChI=1S/C10H16.C6H7.Ir/c1-9-5-3-7-10(2)8-4-6-9;1-6-4-2-3-5-6;/h3,5,7,9H,4,6,8H2,1-2H3;2,4H,3H2,1H3;/q;-1;/b5-3-,10-7-;; |
| InChIKey | KXDDLGYRQFBUAU-LKQDOCJISA-N |
| XLogP | 5.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|