C14H16FeO2 — CID 176507815
bis(1-cyclopenta-2,4-dien-1-ylethanone);iron (PubChem CID 176507815) has the molecular formula C14H16FeO2 and a molecular weight of 272.12 g/mol. Its IUPAC name is bis(1-cyclopenta-2,4-dien-1-ylethanone);iron.
| Compound Name | bis(1-cyclopenta-2,4-dien-1-ylethanone);iron |
|---|---|
| PubChem CID | 176507815 |
| Molecular Formula | C14H16FeO2 |
| Molecular Weight | 272.12 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | bis(1-cyclopenta-2,4-dien-1-ylethanone);iron |
| SMILES | CC(=O)C1C=CC=C1.CC(=O)C1C=CC=C1.[Fe] |
| InChI | InChI=1S/2C7H8O.Fe/c2*1-6(8)7-4-2-3-5-7;/h2*2-5,7H,1H3; |
| InChIKey | QJKFCQKYORHYQF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.12 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|