C6H8FeO3 — CID 175912306
cyclopenta-2,4-diene-1-carboxylic acid;iron;hydrate (PubChem CID 175912306) has the molecular formula C6H8FeO3 and a molecular weight of 183.97 g/mol. Its IUPAC name is cyclopenta-2,4-diene-1-carboxylic acid;iron;hydrate.
| Compound Name | cyclopenta-2,4-diene-1-carboxylic acid;iron;hydrate |
|---|---|
| PubChem CID | 175912306 |
| Molecular Formula | C6H8FeO3 |
| Molecular Weight | 183.97 g/mol |
| Exact Mass | 183.98 |
| IUPAC Name | cyclopenta-2,4-diene-1-carboxylic acid;iron;hydrate |
| SMILES | O.O=C(O)C1C=CC=C1.[Fe] |
| InChI | InChI=1S/C6H6O2.Fe.H2O/c7-6(8)5-3-1-2-4-5;;/h1-5H,(H,7,8);;1H2 |
| InChIKey | XBXNCJWIZWMCOU-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 68.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.97 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|