C9H7F3O2 — CID 102459818
(Z)-1-cyclopenta-2,4-dien-1-yl-4,4,4-trifluoro-3-hydroxybut-2-en-1-one (PubChem CID 102459818) has the molecular formula C9H7F3O2 and a molecular weight of 204.15 g/mol. Its IUPAC name is (Z)-1-cyclopenta-2,4-dien-1-yl-4,4,4-trifluoro-3-hydroxybut-2-en-1-one.
| Compound Name | (Z)-1-cyclopenta-2,4-dien-1-yl-4,4,4-trifluoro-3-hydroxybut-2-en-1-one |
|---|---|
| PubChem CID | 102459818 |
| Molecular Formula | C9H7F3O2 |
| Molecular Weight | 204.15 g/mol |
| Exact Mass | 204.04 |
| IUPAC Name | (Z)-1-cyclopenta-2,4-dien-1-yl-4,4,4-trifluoro-3-hydroxybut-2-en-1-one |
| SMILES | O=C(/C=C(\O)C(F)(F)F)C1C=CC=C1 |
| InChI | InChI=1S/C9H7F3O2/c10-9(11,12)8(14)5-7(13)6-3-1-2-4-6/h1-6,14H/b8-5- |
| InChIKey | GSJLBZMZDMEZNQ-YVMONPNESA-N |
| XLogP | 2.30 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.15 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|