C5H5CuF3O2 — CID 58773962
copper;(Z)-5,5,5-trifluoro-4-hydroxypent-3-en-2-one (PubChem CID 58773962) has the molecular formula C5H5CuF3O2 and a molecular weight of 217.63 g/mol. Its IUPAC name is copper;(Z)-5,5,5-trifluoro-4-hydroxypent-3-en-2-one.
| Compound Name | copper;(Z)-5,5,5-trifluoro-4-hydroxypent-3-en-2-one |
|---|---|
| PubChem CID | 58773962 |
| Molecular Formula | C5H5CuF3O2 |
| Molecular Weight | 217.63 g/mol |
| Exact Mass | 216.95 |
| IUPAC Name | copper;(Z)-5,5,5-trifluoro-4-hydroxypent-3-en-2-one |
| SMILES | CC(=O)/C=C(\O)C(F)(F)F.[Cu] |
| InChI | InChI=1S/C5H5F3O2.Cu/c1-3(9)2-4(10)5(6,7)8;/h2,10H,1H3;/b4-2-; |
| InChIKey | ZOHWUYSVWNKYRE-MKHFZPSSSA-N |
| XLogP | 1.58 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.63 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|