C10H9F3O4 — CID 123439542
2-hydroxycyclopenta-2,4-dien-1-one;(Z)-5,5,5-trifluoro-4-hydroxypent-3-en-2-one (PubChem CID 123439542) has the molecular formula C10H9F3O4 and a molecular weight of 250.17 g/mol. Its IUPAC name is 2-hydroxycyclopenta-2,4-dien-1-one;(Z)-5,5,5-trifluoro-4-hydroxypent-3-en-2-one.
| Compound Name | 2-hydroxycyclopenta-2,4-dien-1-one;(Z)-5,5,5-trifluoro-4-hydroxypent-3-en-2-one |
|---|---|
| PubChem CID | 123439542 |
| Molecular Formula | C10H9F3O4 |
| Molecular Weight | 250.17 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 2-hydroxycyclopenta-2,4-dien-1-one;(Z)-5,5,5-trifluoro-4-hydroxypent-3-en-2-one |
| SMILES | CC(=O)/C=C(\O)C(F)(F)F.O=C1C=CC=C1O |
| InChI | InChI=1S/C5H5F3O2.C5H4O2/c1-3(9)2-4(10)5(6,7)8;6-4-2-1-3-5(4)7/h2,10H,1H3;1-3H,(H,6,7)/b4-2-; |
| InChIKey | FMSNMWZLHUWTFB-MKHFZPSSSA-N |
| XLogP | 2.15 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.17 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|