C8H5ClO3 — CID 88744243
[6-(oxomethylidene)cyclohexa-2,4-dien-1-yl] carbonochloridate (PubChem CID 88744243) has the molecular formula C8H5ClO3 and a molecular weight of 184.58 g/mol. Its IUPAC name is [6-(oxomethylidene)cyclohexa-2,4-dien-1-yl] carbonochloridate.
| Compound Name | [6-(oxomethylidene)cyclohexa-2,4-dien-1-yl] carbonochloridate |
|---|---|
| PubChem CID | 88744243 |
| Molecular Formula | C8H5ClO3 |
| Molecular Weight | 184.58 g/mol |
| Exact Mass | 183.99 |
| IUPAC Name | [6-(oxomethylidene)cyclohexa-2,4-dien-1-yl] carbonochloridate |
| SMILES | O=C=C1C=CC=CC1OC(=O)Cl |
| InChI | InChI=1S/C8H5ClO3/c9-8(11)12-7-4-2-1-3-6(7)5-10/h1-4,7H |
| InChIKey | ARRXOARVJJMXNX-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.58 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|