C9H13ClO2 — CID 142348195
[(Z,2E)-2-ethylidenehex-3-enyl] carbonochloridate (PubChem CID 142348195) has the molecular formula C9H13ClO2 and a molecular weight of 188.65 g/mol. Its IUPAC name is [(Z,2E)-2-ethylidenehex-3-enyl] carbonochloridate.
| Compound Name | [(Z,2E)-2-ethylidenehex-3-enyl] carbonochloridate |
|---|---|
| PubChem CID | 142348195 |
| Molecular Formula | C9H13ClO2 |
| Molecular Weight | 188.65 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | [(Z,2E)-2-ethylidenehex-3-enyl] carbonochloridate |
| SMILES | C/C=C(\C=C/CC)COC(=O)Cl |
| InChI | InChI=1S/C9H13ClO2/c1-3-5-6-8(4-2)7-12-9(10)11/h4-6H,3,7H2,1-2H3/b6-5-,8-4+ |
| InChIKey | HBSDISKEIFXHFE-QNMAEOQASA-N |
| XLogP | 3.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.65 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|