About [(Z,2E)-2-ethylidenehex-3-enyl] carbonochloridate
[(Z,2E)-2-ethylidenehex-3-enyl] carbonochloridate (PubChem CID 142348195) has the molecular formula C9H13ClO2
and a molecular weight of 188.65 g/mol. Its IUPAC name is [(Z,2E)-2-ethylidenehex-3-enyl] carbonochloridate.
Molecular Properties
| Compound Name | [(Z,2E)-2-ethylidenehex-3-enyl] carbonochloridate |
| PubChem CID | 142348195 |
| Molecular Formula | C9H13ClO2 |
| Molecular Weight | 188.65 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | [(Z,2E)-2-ethylidenehex-3-enyl] carbonochloridate |
| SMILES | C/C=C(\C=C/CC)COC(=O)Cl |
| InChI | InChI=1S/C9H13ClO2/c1-3-5-6-8(4-2)7-12-9(10)11/h4-6H,3,7H2,1-2H3/b6-5-,8-4+ |
| InChIKey | HBSDISKEIFXHFE-QNMAEOQASA-N |
| XLogP | 3.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.65 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(Z,2E)-2-ethylidenehex-3-enyl] carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z,2E)-2-ethylidenehex-3-enyl] carbonochloridate?
The IUPAC name of [(Z,2E)-2-ethylidenehex-3-enyl] carbonochloridate (CID 142348195) is [(Z,2E)-2-ethylidenehex-3-enyl] carbonochloridate.
What is the SMILES notation for [(Z,2E)-2-ethylidenehex-3-enyl] carbonochloridate?
The canonical SMILES for [(Z,2E)-2-ethylidenehex-3-enyl] carbonochloridate is C/C=C(\C=C/CC)COC(=O)Cl.
What is the InChIKey of [(Z,2E)-2-ethylidenehex-3-enyl] carbonochloridate?
The InChIKey is HBSDISKEIFXHFE-QNMAEOQASA-N. The full InChI is InChI=1S/C9H13ClO2/c1-3-5-6-8(4-2)7-12-9(10)11/h4-6H,3,7H2,1-2H3/b6-5-,8-4+.
What are the key properties of [(Z,2E)-2-ethylidenehex-3-enyl] carbonochloridate?
[(Z,2E)-2-ethylidenehex-3-enyl] carbonochloridate has a molecular weight of 188.65 g/mol, XLogP of 3.27, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z,2E)-2-ethylidenehex-3-enyl] carbonochloridate is sourced from PubChem (CID 142348195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).