C8H9ClO2 — CID 148937435
[(3Z)-2-methylidenehexa-3,5-dienyl] carbonochloridate (PubChem CID 148937435) has the molecular formula C8H9ClO2 and a molecular weight of 172.61 g/mol. Its IUPAC name is [(3Z)-2-methylidenehexa-3,5-dienyl] carbonochloridate.
| Compound Name | [(3Z)-2-methylidenehexa-3,5-dienyl] carbonochloridate |
|---|---|
| PubChem CID | 148937435 |
| Molecular Formula | C8H9ClO2 |
| Molecular Weight | 172.61 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | [(3Z)-2-methylidenehexa-3,5-dienyl] carbonochloridate |
| SMILES | C=C/C=C\C(=C)COC(=O)Cl |
| InChI | InChI=1S/C8H9ClO2/c1-3-4-5-7(2)6-11-8(9)10/h3-5H,1-2,6H2/b5-4- |
| InChIKey | PNFSDSPJSLNUHY-PLNGDYQASA-N |
| XLogP | 2.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.61 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|