C10H14O3 — CID 146768055
[(4S)-4-methoxycyclohexa-1,5-dien-1-yl]methyl acetate (PubChem CID 146768055) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is [(4S)-4-methoxycyclohexa-1,5-dien-1-yl]methyl acetate.
| Compound Name | [(4S)-4-methoxycyclohexa-1,5-dien-1-yl]methyl acetate |
|---|---|
| PubChem CID | 146768055 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | [(4S)-4-methoxycyclohexa-1,5-dien-1-yl]methyl acetate |
| SMILES | CO[C@@H]1C=CC(COC(C)=O)=CC1 |
| InChI | InChI=1S/C10H14O3/c1-8(11)13-7-9-3-5-10(12-2)6-4-9/h3-5,10H,6-7H2,1-2H3/t10-/m1/s1 |
| InChIKey | RRAAXELDFGKEKM-SNVBAGLBSA-N |
| XLogP | 1.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |