About dodecan-4-ol;(6-hydroxycyclohexa-2,4-dien-1-ylidene)methanone
dodecan-4-ol;(6-hydroxycyclohexa-2,4-dien-1-ylidene)methanone (PubChem CID 158454855) has the molecular formula C19H32O3
and a molecular weight of 308.46 g/mol. Its IUPAC name is dodecan-4-ol;(6-hydroxycyclohexa-2,4-dien-1-ylidene)methanone.
Molecular Properties
| Compound Name | dodecan-4-ol;(6-hydroxycyclohexa-2,4-dien-1-ylidene)methanone |
| PubChem CID | 158454855 |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | dodecan-4-ol;(6-hydroxycyclohexa-2,4-dien-1-ylidene)methanone |
| SMILES | CCCCCCCCC(O)CCC.O=C=C1C=CC=CC1O |
| InChI | InChI=1S/C12H26O.C7H6O2/c1-3-5-6-7-8-9-11-12(13)10-4-2;8-5-6-3-1-2-4-7(6)9/h12-13H,3-11H2,1-2H3;1-4,7,9H |
| InChIKey | ZCNRZARMSJUUMY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze dodecan-4-ol;(6-hydroxycyclohexa-2,4-dien-1-ylidene)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodecan-4-ol;(6-hydroxycyclohexa-2,4-dien-1-ylidene)methanone?
The IUPAC name of dodecan-4-ol;(6-hydroxycyclohexa-2,4-dien-1-ylidene)methanone (CID 158454855) is dodecan-4-ol;(6-hydroxycyclohexa-2,4-dien-1-ylidene)methanone.
What is the SMILES notation for dodecan-4-ol;(6-hydroxycyclohexa-2,4-dien-1-ylidene)methanone?
The canonical SMILES for dodecan-4-ol;(6-hydroxycyclohexa-2,4-dien-1-ylidene)methanone is CCCCCCCCC(O)CCC.O=C=C1C=CC=CC1O.
What is the InChIKey of dodecan-4-ol;(6-hydroxycyclohexa-2,4-dien-1-ylidene)methanone?
The InChIKey is ZCNRZARMSJUUMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O.C7H6O2/c1-3-5-6-7-8-9-11-12(13)10-4-2;8-5-6-3-1-2-4-7(6)9/h12-13H,3-11H2,1-2H3;1-4,7,9H.
What are the key properties of dodecan-4-ol;(6-hydroxycyclohexa-2,4-dien-1-ylidene)methanone?
dodecan-4-ol;(6-hydroxycyclohexa-2,4-dien-1-ylidene)methanone has a molecular weight of 308.46 g/mol, XLogP of 4.13, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dodecan-4-ol;(6-hydroxycyclohexa-2,4-dien-1-ylidene)methanone is sourced from PubChem (CID 158454855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).