C13H18O6 — CID 86746901
acetic acid;(2,3-diethoxy-6-hydroxycyclohexa-2,4-dien-1-ylidene)methanone (PubChem CID 86746901) has the molecular formula C13H18O6 and a molecular weight of 270.28 g/mol. Its IUPAC name is acetic acid;(2,3-diethoxy-6-hydroxycyclohexa-2,4-dien-1-ylidene)methanone.
| Compound Name | acetic acid;(2,3-diethoxy-6-hydroxycyclohexa-2,4-dien-1-ylidene)methanone |
|---|---|
| PubChem CID | 86746901 |
| Molecular Formula | C13H18O6 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | acetic acid;(2,3-diethoxy-6-hydroxycyclohexa-2,4-dien-1-ylidene)methanone |
| SMILES | CC(=O)O.CCOC1=C(OCC)C(=C=O)C(O)C=C1 |
| InChI | InChI=1S/C11H14O4.C2H4O2/c1-3-14-10-6-5-9(13)8(7-12)11(10)15-4-2;1-2(3)4/h5-6,9,13H,3-4H2,1-2H3;1H3,(H,3,4) |
| InChIKey | FJRHMEOZCCHPJH-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|