C12H17NO2 — CID 176520573
[3-hydroxy-6-(pentylamino)cyclohexa-2,4-dien-1-ylidene]methanone (PubChem CID 176520573) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is [3-hydroxy-6-(pentylamino)cyclohexa-2,4-dien-1-ylidene]methanone.
| Compound Name | [3-hydroxy-6-(pentylamino)cyclohexa-2,4-dien-1-ylidene]methanone |
|---|---|
| PubChem CID | 176520573 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | [3-hydroxy-6-(pentylamino)cyclohexa-2,4-dien-1-ylidene]methanone |
| SMILES | CCCCCNC1C=CC(O)=CC1=C=O |
| InChI | InChI=1S/C12H17NO2/c1-2-3-4-7-13-12-6-5-11(15)8-10(12)9-14/h5-6,8,12-13,15H,2-4,7H2,1H3 |
| InChIKey | VJUIOSHKQIJURP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|