C16H31NO3 — CID 72699699
(1R,2R,3R,6S)-6-(decylamino)cyclohex-4-ene-1,2,3-triol (PubChem CID 72699699) has the molecular formula C16H31NO3 and a molecular weight of 285.43 g/mol. Its IUPAC name is (1R,2R,3R,6S)-6-(decylamino)cyclohex-4-ene-1,2,3-triol.
| Compound Name | (1R,2R,3R,6S)-6-(decylamino)cyclohex-4-ene-1,2,3-triol |
|---|---|
| PubChem CID | 72699699 |
| Molecular Formula | C16H31NO3 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.23 |
| IUPAC Name | (1R,2R,3R,6S)-6-(decylamino)cyclohex-4-ene-1,2,3-triol |
| SMILES | CCCCCCCCCCN[C@H]1C=C[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H31NO3/c1-2-3-4-5-6-7-8-9-12-17-13-10-11-14(18)16(20)15(13)19/h10-11,13-20H,2-9,12H2,1H3/t13-,14+,15+,16+/m0/s1 |
| InChIKey | RWBMWSIKDJBMAC-ZJIFWQFVSA-N |
| XLogP | 1.74 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|