C15H31NO5 — CID 122395553
(1R,2S,3S,4R,5R,6S)-5-(hydroxymethyl)-6-(octylamino)cyclohexane-1,2,3,4-tetrol (PubChem CID 122395553) has the molecular formula C15H31NO5 and a molecular weight of 305.42 g/mol. Its IUPAC name is (1R,2S,3S,4R,5R,6S)-5-(hydroxymethyl)-6-(octylamino)cyclohexane-1,2,3,4-tetrol.
| Compound Name | (1R,2S,3S,4R,5R,6S)-5-(hydroxymethyl)-6-(octylamino)cyclohexane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 122395553 |
| Molecular Formula | C15H31NO5 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | (1R,2S,3S,4R,5R,6S)-5-(hydroxymethyl)-6-(octylamino)cyclohexane-1,2,3,4-tetrol |
| SMILES | CCCCCCCCN[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO |
| InChI | InChI=1S/C15H31NO5/c1-2-3-4-5-6-7-8-16-11-10(9-17)12(18)14(20)15(21)13(11)19/h10-21H,2-9H2,1H3/t10-,11-,12+,13+,14-,15-/m0/s1 |
| InChIKey | XRKAXZKTXGJDHH-SAAWNECCSA-N |
| XLogP | -0.63 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|