C16H31NO3 — CID 78426170
(3S,3aR,6R,6aR)-3-(decylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol (PubChem CID 78426170) has the molecular formula C16H31NO3 and a molecular weight of 285.43 g/mol. Its IUPAC name is (3S,3aR,6R,6aR)-3-(decylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol.
| Compound Name | (3S,3aR,6R,6aR)-3-(decylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol |
|---|---|
| PubChem CID | 78426170 |
| Molecular Formula | C16H31NO3 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.23 |
| IUPAC Name | (3S,3aR,6R,6aR)-3-(decylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol |
| SMILES | CCCCCCCCCCN[C@H]1CO[C@H]2[C@@H]1OC[C@H]2O |
| InChI | InChI=1S/C16H31NO3/c1-2-3-4-5-6-7-8-9-10-17-13-11-19-16-14(18)12-20-15(13)16/h13-18H,2-12H2,1H3/t13-,14+,15+,16+/m0/s1 |
| InChIKey | VQKZEPMHZGKLNL-ZJIFWQFVSA-N |
| XLogP | 2.24 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|