C19H30ClNO — CID 67882682
5,7-dimethyl-3-(octylamino)-3H-inden-4-ol;hydrochloride (PubChem CID 67882682) has the molecular formula C19H30ClNO and a molecular weight of 323.91 g/mol. Its IUPAC name is 5,7-dimethyl-3-(octylamino)-3H-inden-4-ol;hydrochloride.
| Compound Name | 5,7-dimethyl-3-(octylamino)-3H-inden-4-ol;hydrochloride |
|---|---|
| PubChem CID | 67882682 |
| Molecular Formula | C19H30ClNO |
| Molecular Weight | 323.91 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 5,7-dimethyl-3-(octylamino)-3H-inden-4-ol;hydrochloride |
| SMILES | CCCCCCCCNC1C=Cc2c(C)cc(C)c(O)c21.Cl |
| InChI | InChI=1S/C19H29NO.ClH/c1-4-5-6-7-8-9-12-20-17-11-10-16-14(2)13-15(3)19(21)18(16)17;/h10-11,13,17,20-21H,4-9,12H2,1-3H3;1H |
| InChIKey | CBNXXYNBRFHGJP-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.91 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|