C16H22O — CID 134945146
(1R,2S)-2-butyl-5,8-dimethyl-1,2-dihydronaphthalen-1-ol (PubChem CID 134945146) has the molecular formula C16H22O and a molecular weight of 230.35 g/mol. Its IUPAC name is (1R,2S)-2-butyl-5,8-dimethyl-1,2-dihydronaphthalen-1-ol.
| Compound Name | (1R,2S)-2-butyl-5,8-dimethyl-1,2-dihydronaphthalen-1-ol |
|---|---|
| PubChem CID | 134945146 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | (1R,2S)-2-butyl-5,8-dimethyl-1,2-dihydronaphthalen-1-ol |
| SMILES | CCCC[C@H]1C=Cc2c(C)ccc(C)c2[C@@H]1O |
| InChI | InChI=1S/C16H22O/c1-4-5-6-13-9-10-14-11(2)7-8-12(3)15(14)16(13)17/h7-10,13,16-17H,4-6H2,1-3H3/t13-,16+/m0/s1 |
| InChIKey | ZYCXLQDRDSFYFK-XJKSGUPXSA-N |
| XLogP | 4.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |