C21H26Cl2Zr — CID 162260623
1-(cyclopenta-2,4-dien-1-ylmethyl)-4-methyl-7-pentyl-1H-indene;zirconium(2+);dichloride (PubChem CID 162260623) has the molecular formula C21H26Cl2Zr and a molecular weight of 440.57 g/mol. Its IUPAC name is 1-(cyclopenta-2,4-dien-1-ylmethyl)-4-methyl-7-pentyl-1H-indene;zirconium(2+);dichloride.
| Compound Name | 1-(cyclopenta-2,4-dien-1-ylmethyl)-4-methyl-7-pentyl-1H-indene;zirconium(2+);dichloride |
|---|---|
| PubChem CID | 162260623 |
| Molecular Formula | C21H26Cl2Zr |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | 1-(cyclopenta-2,4-dien-1-ylmethyl)-4-methyl-7-pentyl-1H-indene;zirconium(2+);dichloride |
| SMILES | CCCCCc1ccc(C)c2c1C(CC1C=CC=C1)C=C2.[Cl-].[Cl-].[Zr+2] |
| InChI | InChI=1S/C21H26.2ClH.Zr/c1-3-4-5-10-18-12-11-16(2)20-14-13-19(21(18)20)15-17-8-6-7-9-17;;;/h6-9,11-14,17,19H,3-5,10,15H2,1-2H3;2*1H;/q;;;+2/p-2 |
| InChIKey | VBCKBNXJMALVMD-UHFFFAOYSA-L |
| XLogP | -0.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|