C22H42 — CID 21497713
3,4,5,6-tetrabutylcyclohexene (PubChem CID 21497713) has the molecular formula C22H42 and a molecular weight of 306.58 g/mol. Its IUPAC name is 3,4,5,6-tetrabutylcyclohexene.
| Compound Name | 3,4,5,6-tetrabutylcyclohexene |
|---|---|
| PubChem CID | 21497713 |
| Molecular Formula | C22H42 |
| Molecular Weight | 306.58 g/mol |
| Exact Mass | 306.33 |
| IUPAC Name | 3,4,5,6-tetrabutylcyclohexene |
| SMILES | CCCCC1C=CC(CCCC)C(CCCC)C1CCCC |
| InChI | InChI=1S/C22H42/c1-5-9-13-19-17-18-20(14-10-6-2)22(16-12-8-4)21(19)15-11-7-3/h17-22H,5-16H2,1-4H3 |
| InChIKey | OJPONJHYJOSQSC-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.58 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|