C36H64O4 — CID 162301368
bis(carbon dioxide);3,4-diheptyl-6-hexyl-5-oct-2-enylcyclohexene (PubChem CID 162301368) has the molecular formula C36H64O4 and a molecular weight of 560.90 g/mol. Its IUPAC name is bis(carbon dioxide);3,4-diheptyl-6-hexyl-5-oct-2-enylcyclohexene.
| Compound Name | bis(carbon dioxide);3,4-diheptyl-6-hexyl-5-oct-2-enylcyclohexene |
|---|---|
| PubChem CID | 162301368 |
| Molecular Formula | C36H64O4 |
| Molecular Weight | 560.90 g/mol |
| Exact Mass | 560.48 |
| IUPAC Name | bis(carbon dioxide);3,4-diheptyl-6-hexyl-5-oct-2-enylcyclohexene |
| SMILES | CCCCCC=CCC1C(CCCCCC)C=CC(CCCCCCC)C1CCCCCCC.O=C=O.O=C=O |
| InChI | InChI=1S/C34H64.2CO2/c1-5-9-13-17-20-24-28-34-31(25-21-16-12-8-4)29-30-32(26-22-18-14-10-6-2)33(34)27-23-19-15-11-7-3;2*2-1-3/h20,24,29-34H,5-19,21-23,25-28H2,1-4H3;; |
| InChIKey | SBRLIUJTLSITKX-UHFFFAOYSA-N |
| XLogP | 11.07 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.90 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|