C72H126O8 — CID 123916569
9-[13-[5,6-bis(7-carboxyheptyl)-2-hexylcyclohex-3-en-1-yl]-7,8-diethyltrideca-3,11-dienylidene]-10-non-3-enyloctadecanedioic acid (PubChem CID 123916569) has the molecular formula C72H126O8 and a molecular weight of 1119.79 g/mol. Its IUPAC name is 9-[13-[5,6-bis(7-carboxyheptyl)-2-hexylcyclohex-3-en-1-yl]-7,8-diethyltrideca-3,11-dienylidene]-10-non-3-enyloctadecanedioic acid.
| Compound Name | 9-[13-[5,6-bis(7-carboxyheptyl)-2-hexylcyclohex-3-en-1-yl]-7,8-diethyltrideca-3,11-dienylidene]-10-non-3-enyloctadecanedioic acid |
|---|---|
| PubChem CID | 123916569 |
| Molecular Formula | C72H126O8 |
| Molecular Weight | 1119.79 g/mol |
| Exact Mass | 1118.95 |
| IUPAC Name | 9-[13-[5,6-bis(7-carboxyheptyl)-2-hexylcyclohex-3-en-1-yl]-7,8-diethyltrideca-3,11-dienylidene]-10-non-3-enyloctadecanedioic acid |
| SMILES | CCCCCC=CCCC(CCCCCCCC(=O)O)C(=CCC=CCCC(CC)C(CC)CCC=CCC1C(CCCCCC)C=CC(CCCCCCCC(=O)O)C1CCCCCCCC(=O)O)CCCCCCCC(=O)O |
| InChI | InChI=1S/C72H126O8/c1-5-9-11-13-14-19-33-47-63(48-34-20-15-24-41-55-69(73)74)64(49-35-21-16-25-42-56-70(75)76)50-36-29-28-32-45-61(7-3)62(8-4)46-38-30-40-54-68-65(51-31-12-10-6-2)59-60-66(52-37-22-17-26-43-57-71(77)78)67(68)53-39-23-18-27-44-58-72(79)80/h14,19,28-30,40,50,59-63,65-68H,5-13,15-18,20-27,31-39,41-49,51-58H2,1-4H3,(H,73,74)(H,75,76)(H,77,78)(H,79,80) |
| InChIKey | HXMQEQLSVCZEEO-UHFFFAOYSA-N |
| XLogP | 22.22 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 58 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1119.79 |
| LogP ≤ 5 | 22.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|