C36H68O4 — CID 98118346
(9S,10R)-9-[(Z)-non-3-enyl]-10-octylnonadecanedioic acid (PubChem CID 98118346) has the molecular formula C36H68O4 and a molecular weight of 564.94 g/mol. Its IUPAC name is (9S,10R)-9-[(Z)-non-3-enyl]-10-octylnonadecanedioic acid.
| Compound Name | (9S,10R)-9-[(Z)-non-3-enyl]-10-octylnonadecanedioic acid |
|---|---|
| PubChem CID | 98118346 |
| Molecular Formula | C36H68O4 |
| Molecular Weight | 564.94 g/mol |
| Exact Mass | 564.51 |
| IUPAC Name | (9S,10R)-9-[(Z)-non-3-enyl]-10-octylnonadecanedioic acid |
| SMILES | CCCCC/C=C\CCC(CCCCCCCC(=O)O)[C@H](CCCCCCCC)CCCCCCCCC(=O)O |
| InChI | InChI=1S/C36H68O4/c1-3-5-7-9-11-16-22-28-34(30-24-18-14-20-26-32-36(39)40)33(27-21-15-10-8-6-4-2)29-23-17-12-13-19-25-31-35(37)38/h11,16,33-34H,3-10,12-15,17-32H2,1-2H3,(H,37,38)(H,39,40)/b16-11-/t33-,34?/m1/s1 |
| InChIKey | AMOKUAKXKXBFIW-GVGNIQKZSA-N |
| XLogP | 11.91 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.94 |
| LogP ≤ 5 | 11.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|