C30H58N2 — CID 138748896
(8Z)-7-[(E)-oct-3-enyl]-8-[(E)-oct-3-enylidene]tetradecane-1,14-diamine (PubChem CID 138748896) has the molecular formula C30H58N2 and a molecular weight of 446.81 g/mol. Its IUPAC name is (8Z)-7-[(E)-oct-3-enyl]-8-[(E)-oct-3-enylidene]tetradecane-1,14-diamine.
| Compound Name | (8Z)-7-[(E)-oct-3-enyl]-8-[(E)-oct-3-enylidene]tetradecane-1,14-diamine |
|---|---|
| PubChem CID | 138748896 |
| Molecular Formula | C30H58N2 |
| Molecular Weight | 446.81 g/mol |
| Exact Mass | 446.46 |
| IUPAC Name | (8Z)-7-[(E)-oct-3-enyl]-8-[(E)-oct-3-enylidene]tetradecane-1,14-diamine |
| SMILES | CCCC/C=C/C/C=C(/CCCCCCN)C(CC/C=C/CCCC)CCCCCCN |
| InChI | InChI=1S/C30H58N2/c1-3-5-7-9-11-17-23-29(25-19-13-15-21-27-31)30(26-20-14-16-22-28-32)24-18-12-10-8-6-4-2/h9-12,23,30H,3-8,13-22,24-28,31-32H2,1-2H3/b11-9+,12-10+,29-23- |
| InChIKey | OHGHVSBFZRMYJA-XYEBVNFUSA-N |
| XLogP | 9.01 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.81 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|