C43H75NO2 — CID 170129115
[(6Z,9Z,12Z,25Z,28Z,31Z)-18-methylheptatriaconta-6,9,12,25,28,31-hexaen-19-yl] 5-aminopentanoate (PubChem CID 170129115) has the molecular formula C43H75NO2 and a molecular weight of 638.08 g/mol. Its IUPAC name is [(6Z,9Z,12Z,25Z,28Z,31Z)-18-methylheptatriaconta-6,9,12,25,28,31-hexaen-19-yl] 5-aminopentanoate.
| Compound Name | [(6Z,9Z,12Z,25Z,28Z,31Z)-18-methylheptatriaconta-6,9,12,25,28,31-hexaen-19-yl] 5-aminopentanoate |
|---|---|
| PubChem CID | 170129115 |
| Molecular Formula | C43H75NO2 |
| Molecular Weight | 638.08 g/mol |
| Exact Mass | 637.58 |
| IUPAC Name | [(6Z,9Z,12Z,25Z,28Z,31Z)-18-methylheptatriaconta-6,9,12,25,28,31-hexaen-19-yl] 5-aminopentanoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CCCCCC(OC(=O)CCCCN)C(C)CCCC/C=C\C/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C43H75NO2/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-38-42(46-43(45)39-35-36-40-44)41(3)37-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21,24-27,41-42H,4-11,16-17,22-23,28-40,44H2,1-3H3/b14-12-,15-13-,20-18-,21-19-,26-24-,27-25- |
| InChIKey | XNCLCEKGKNOEQV-NSDKMMGWSA-N |
| XLogP | 13.23 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.08 |
| LogP ≤ 5 | 13.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|