C32H56O4 — CID 159338776
[(9Z,12E)-9-(7-formyloxyheptyl)-8-[(E)-hept-3-enyl]hexadeca-9,12-dienyl] formate (PubChem CID 159338776) has the molecular formula C32H56O4 and a molecular weight of 504.80 g/mol. Its IUPAC name is [(9Z,12E)-9-(7-formyloxyheptyl)-8-[(E)-hept-3-enyl]hexadeca-9,12-dienyl] formate.
| Compound Name | [(9Z,12E)-9-(7-formyloxyheptyl)-8-[(E)-hept-3-enyl]hexadeca-9,12-dienyl] formate |
|---|---|
| PubChem CID | 159338776 |
| Molecular Formula | C32H56O4 |
| Molecular Weight | 504.80 g/mol |
| Exact Mass | 504.42 |
| IUPAC Name | [(9Z,12E)-9-(7-formyloxyheptyl)-8-[(E)-hept-3-enyl]hexadeca-9,12-dienyl] formate |
| SMILES | CCC/C=C/C/C=C(/CCCCCCCOC=O)C(CC/C=C/CCC)CCCCCCCOC=O |
| InChI | InChI=1S/C32H56O4/c1-3-5-7-11-17-23-31(25-19-13-9-15-21-27-35-29-33)32(24-18-12-8-6-4-2)26-20-14-10-16-22-28-36-30-34/h7-8,11-12,23,29-30,32H,3-6,9-10,13-22,24-28H2,1-2H3/b11-7+,12-8+,31-23- |
| InChIKey | CXACWMOSKSLHQE-CUBMBCDUSA-N |
| XLogP | 9.44 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.80 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|