C22H42O — CID 100991951
(2R,3R)-2-[(Z)-pentadec-2-enyl]-3-pentyloxirane (PubChem CID 100991951) has the molecular formula C22H42O and a molecular weight of 322.58 g/mol. Its IUPAC name is (2R,3R)-2-[(Z)-pentadec-2-enyl]-3-pentyloxirane.
| Compound Name | (2R,3R)-2-[(Z)-pentadec-2-enyl]-3-pentyloxirane |
|---|---|
| PubChem CID | 100991951 |
| Molecular Formula | C22H42O |
| Molecular Weight | 322.58 g/mol |
| Exact Mass | 322.32 |
| IUPAC Name | (2R,3R)-2-[(Z)-pentadec-2-enyl]-3-pentyloxirane |
| SMILES | CCCCCCCCCCCC/C=C\C[C@H]1O[C@@H]1CCCCC |
| InChI | InChI=1S/C22H42O/c1-3-5-7-8-9-10-11-12-13-14-15-16-18-20-22-21(23-22)19-17-6-4-2/h16,18,21-22H,3-15,17,19-20H2,1-2H3/b18-16-/t21-,22-/m1/s1 |
| InChIKey | AYSSQAAUOFCRTO-QGSCIIRKSA-N |
| XLogP | 7.59 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.58 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|