C19H34O — CID 171042832
(2S,3R)-2-nonyl-3-[(2E,5E)-octa-2,5-dienyl]oxirane (PubChem CID 171042832) has the molecular formula C19H34O and a molecular weight of 278.48 g/mol. Its IUPAC name is (2S,3R)-2-nonyl-3-[(2E,5E)-octa-2,5-dienyl]oxirane.
| Compound Name | (2S,3R)-2-nonyl-3-[(2E,5E)-octa-2,5-dienyl]oxirane |
|---|---|
| PubChem CID | 171042832 |
| Molecular Formula | C19H34O |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.26 |
| IUPAC Name | (2S,3R)-2-nonyl-3-[(2E,5E)-octa-2,5-dienyl]oxirane |
| SMILES | CC/C=C/C/C=C/C[C@H]1O[C@H]1CCCCCCCCC |
| InChI | InChI=1S/C19H34O/c1-3-5-7-9-11-13-15-17-19-18(20-19)16-14-12-10-8-6-4-2/h6,8,12,14,18-19H,3-5,7,9-11,13,15-17H2,1-2H3/b8-6+,14-12+/t18-,19+/m1/s1 |
| InChIKey | CEWBAXULNPORDY-BEUYQMBYSA-N |
| XLogP | 6.20 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|