C21H36O — CID 14333997
(2R,3S)-2-[(2Z,5Z)-octa-2,5,7-trienyl]-3-undecyloxirane (PubChem CID 14333997) has the molecular formula C21H36O and a molecular weight of 304.52 g/mol. Its IUPAC name is (2R,3S)-2-[(2Z,5Z)-octa-2,5,7-trienyl]-3-undecyloxirane.
| Compound Name | (2R,3S)-2-[(2Z,5Z)-octa-2,5,7-trienyl]-3-undecyloxirane |
|---|---|
| PubChem CID | 14333997 |
| Molecular Formula | C21H36O |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.28 |
| IUPAC Name | (2R,3S)-2-[(2Z,5Z)-octa-2,5,7-trienyl]-3-undecyloxirane |
| SMILES | C=C/C=C\C/C=C\C[C@H]1O[C@H]1CCCCCCCCCCC |
| InChI | InChI=1S/C21H36O/c1-3-5-7-9-11-12-13-15-17-19-21-20(22-21)18-16-14-10-8-6-4-2/h4,6,8,14,16,20-21H,2-3,5,7,9-13,15,17-19H2,1H3/b8-6-,16-14-/t20-,21+/m1/s1 |
| InChIKey | MNOQVNSRLYAHLG-LXOZGROOSA-N |
| XLogP | 6.75 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|