C18H32O — CID 141312981
(2R,3S)-2-[(2E)-penta-2,4-dienyl]-3-undecyloxirane (PubChem CID 141312981) has the molecular formula C18H32O and a molecular weight of 264.45 g/mol. Its IUPAC name is (2R,3S)-2-[(2E)-penta-2,4-dienyl]-3-undecyloxirane.
| Compound Name | (2R,3S)-2-[(2E)-penta-2,4-dienyl]-3-undecyloxirane |
|---|---|
| PubChem CID | 141312981 |
| Molecular Formula | C18H32O |
| Molecular Weight | 264.45 g/mol |
| Exact Mass | 264.25 |
| IUPAC Name | (2R,3S)-2-[(2E)-penta-2,4-dienyl]-3-undecyloxirane |
| SMILES | C=C/C=C/C[C@H]1O[C@H]1CCCCCCCCCCC |
| InChI | InChI=1S/C18H32O/c1-3-5-7-8-9-10-11-12-14-16-18-17(19-18)15-13-6-4-2/h4,6,13,17-18H,2-3,5,7-12,14-16H2,1H3/b13-6+/t17-,18+/m1/s1 |
| InChIKey | CSEFJKRSPGWYBI-RTQVWNLFSA-N |
| XLogP | 5.81 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.45 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|