C22H38O — CID 90702602
2-pentadeca-10,12,14-trienyl-3-pentyloxirane (PubChem CID 90702602) has the molecular formula C22H38O and a molecular weight of 318.54 g/mol. Its IUPAC name is 2-pentadeca-10,12,14-trienyl-3-pentyloxirane.
| Compound Name | 2-pentadeca-10,12,14-trienyl-3-pentyloxirane |
|---|---|
| PubChem CID | 90702602 |
| Molecular Formula | C22H38O |
| Molecular Weight | 318.54 g/mol |
| Exact Mass | 318.29 |
| IUPAC Name | 2-pentadeca-10,12,14-trienyl-3-pentyloxirane |
| SMILES | C=CC=CC=CCCCCCCCCCC1OC1CCCCC |
| InChI | InChI=1S/C22H38O/c1-3-5-7-8-9-10-11-12-13-14-15-16-18-20-22-21(23-22)19-17-6-4-2/h3,5,7-9,21-22H,1,4,6,10-20H2,2H3 |
| InChIKey | JIXCQMYEHYPJOI-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.54 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|