C18H28O3 — CID 87347031
(2E,4E,6E)-11-(3-pentyloxiran-2-yl)undeca-2,4,6-trienoic acid (PubChem CID 87347031) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is (2E,4E,6E)-11-(3-pentyloxiran-2-yl)undeca-2,4,6-trienoic acid.
| Compound Name | (2E,4E,6E)-11-(3-pentyloxiran-2-yl)undeca-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 87347031 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | (2E,4E,6E)-11-(3-pentyloxiran-2-yl)undeca-2,4,6-trienoic acid |
| SMILES | CCCCCC1OC1CCCC/C=C/C=C/C=C/C(=O)O |
| InChI | InChI=1S/C18H28O3/c1-2-3-10-13-16-17(21-16)14-11-8-6-4-5-7-9-12-15-18(19)20/h4-5,7,9,12,15-17H,2-3,6,8,10-11,13-14H2,1H3,(H,19,20)/b5-4+,9-7+,15-12+ |
| InChIKey | QCPQNCQZWOFFJY-MSPVNQSVSA-N |
| XLogP | 4.65 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|