C18H32O2 — CID 175142934
8-(3-octyloxiran-2-yl)octa-1,3-dien-1-ol (PubChem CID 175142934) has the molecular formula C18H32O2 and a molecular weight of 280.45 g/mol. Its IUPAC name is 8-(3-octyloxiran-2-yl)octa-1,3-dien-1-ol.
| Compound Name | 8-(3-octyloxiran-2-yl)octa-1,3-dien-1-ol |
|---|---|
| PubChem CID | 175142934 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | 8-(3-octyloxiran-2-yl)octa-1,3-dien-1-ol |
| SMILES | CCCCCCCCC1OC1CCCCC=CC=CO |
| InChI | InChI=1S/C18H32O2/c1-2-3-4-5-8-11-14-17-18(20-17)15-12-9-6-7-10-13-16-19/h7,10,13,16-19H,2-6,8-9,11-12,14-15H2,1H3 |
| InChIKey | KMCYPWIOAKVWGJ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|