C17H30O — CID 56936249
(2S,3R)-2-[(2Z,5Z)-hepta-2,5-dienyl]-3-octyloxirane (PubChem CID 56936249) has the molecular formula C17H30O and a molecular weight of 250.43 g/mol. Its IUPAC name is (2S,3R)-2-[(2Z,5Z)-hepta-2,5-dienyl]-3-octyloxirane.
| Compound Name | (2S,3R)-2-[(2Z,5Z)-hepta-2,5-dienyl]-3-octyloxirane |
|---|---|
| PubChem CID | 56936249 |
| Molecular Formula | C17H30O |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.23 |
| IUPAC Name | (2S,3R)-2-[(2Z,5Z)-hepta-2,5-dienyl]-3-octyloxirane |
| SMILES | C/C=C\C/C=C\C[C@@H]1O[C@@H]1CCCCCCCC |
| InChI | InChI=1S/C17H30O/c1-3-5-7-9-11-13-15-17-16(18-17)14-12-10-8-6-4-2/h4,6,10,12,16-17H,3,5,7-9,11,13-15H2,1-2H3/b6-4-,12-10-/t16-,17+/m0/s1 |
| InChIKey | CNYHVWZOWVYRKM-YNOGVTSOSA-N |
| XLogP | 5.42 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|