C37H64O6 — CID 88567199
[(Z)-11-[(2R,3S)-3-pentyloxiran-2-yl]undec-9-enoyl]oxymethyl (Z)-11-[(2S,3R)-3-pentyloxiran-2-yl]undec-9-enoate (PubChem CID 88567199) has the molecular formula C37H64O6 and a molecular weight of 604.91 g/mol. Its IUPAC name is [(Z)-11-[(2R,3S)-3-pentyloxiran-2-yl]undec-9-enoyl]oxymethyl (Z)-11-[(2S,3R)-3-pentyloxiran-2-yl]undec-9-enoate.
| Compound Name | [(Z)-11-[(2R,3S)-3-pentyloxiran-2-yl]undec-9-enoyl]oxymethyl (Z)-11-[(2S,3R)-3-pentyloxiran-2-yl]undec-9-enoate |
|---|---|
| PubChem CID | 88567199 |
| Molecular Formula | C37H64O6 |
| Molecular Weight | 604.91 g/mol |
| Exact Mass | 604.47 |
| IUPAC Name | [(Z)-11-[(2R,3S)-3-pentyloxiran-2-yl]undec-9-enoyl]oxymethyl (Z)-11-[(2S,3R)-3-pentyloxiran-2-yl]undec-9-enoate |
| SMILES | CCCCC[C@@H]1O[C@@H]1C/C=C\CCCCCCCC(=O)OCOC(=O)CCCCCCC/C=C\C[C@@H]1O[C@@H]1CCCCC |
| InChI | InChI=1S/C37H64O6/c1-3-5-19-25-32-34(42-32)27-21-15-11-7-9-13-17-23-29-36(38)40-31-41-37(39)30-24-18-14-10-8-12-16-22-28-35-33(43-35)26-20-6-4-2/h15-16,21-22,32-35H,3-14,17-20,23-31H2,1-2H3/b21-15-,22-16-/t32-,33+,34+,35- |
| InChIKey | YJBDDDITAPQRLT-CAROFHOOSA-N |
| XLogP | 10.08 |
| TPSA | 77.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.91 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|