C21H38O5 — CID 162873724
[(2R)-2,3-dihydroxypropyl] 11-[(2R,3S)-3-pentyloxiran-2-yl]undec-9-enoate (PubChem CID 162873724) has the molecular formula C21H38O5 and a molecular weight of 370.53 g/mol. Its IUPAC name is [(2R)-2,3-dihydroxypropyl] 11-[(2R,3S)-3-pentyloxiran-2-yl]undec-9-enoate.
| Compound Name | [(2R)-2,3-dihydroxypropyl] 11-[(2R,3S)-3-pentyloxiran-2-yl]undec-9-enoate |
|---|---|
| PubChem CID | 162873724 |
| Molecular Formula | C21H38O5 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | [(2R)-2,3-dihydroxypropyl] 11-[(2R,3S)-3-pentyloxiran-2-yl]undec-9-enoate |
| SMILES | CCCCC[C@@H]1O[C@@H]1CC=CCCCCCCCC(=O)OC[C@H](O)CO |
| InChI | InChI=1S/C21H38O5/c1-2-3-10-13-19-20(26-19)14-11-8-6-4-5-7-9-12-15-21(24)25-17-18(23)16-22/h8,11,18-20,22-23H,2-7,9-10,12-17H2,1H3/t18-,19+,20-/m1/s1 |
| InChIKey | FYCPUPBOVLIBDH-HSALFYBXSA-N |
| XLogP | 3.91 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|