C23H40O6 — CID 157005077
[(2S)-3-acetyloxy-2-hydroxypropyl] 8-[3-[(Z)-oct-2-enyl]oxiran-2-yl]octanoate (PubChem CID 157005077) has the molecular formula C23H40O6 and a molecular weight of 412.57 g/mol. Its IUPAC name is [(2S)-3-acetyloxy-2-hydroxypropyl] 8-[3-[(Z)-oct-2-enyl]oxiran-2-yl]octanoate.
| Compound Name | [(2S)-3-acetyloxy-2-hydroxypropyl] 8-[3-[(Z)-oct-2-enyl]oxiran-2-yl]octanoate |
|---|---|
| PubChem CID | 157005077 |
| Molecular Formula | C23H40O6 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | [(2S)-3-acetyloxy-2-hydroxypropyl] 8-[3-[(Z)-oct-2-enyl]oxiran-2-yl]octanoate |
| SMILES | CCCCC/C=C\CC1OC1CCCCCCCC(=O)OC[C@@H](O)COC(C)=O |
| InChI | InChI=1S/C23H40O6/c1-3-4-5-6-8-11-14-21-22(29-21)15-12-9-7-10-13-16-23(26)28-18-20(25)17-27-19(2)24/h8,11,20-22,25H,3-7,9-10,12-18H2,1-2H3/b11-8-/t20-,21?,22?/m0/s1 |
| InChIKey | WRCWIULRGPEKNL-QQXARWCLSA-N |
| XLogP | 4.48 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|