C33H56O6 — CID 157002510
[(2R)-3-decanoyloxy-2-hydroxypropyl] (5Z,8Z)-10-[3-[(Z)-oct-2-enyl]oxiran-2-yl]deca-5,8-dienoate (PubChem CID 157002510) has the molecular formula C33H56O6 and a molecular weight of 548.81 g/mol. Its IUPAC name is [(2R)-3-decanoyloxy-2-hydroxypropyl] (5Z,8Z)-10-[3-[(Z)-oct-2-enyl]oxiran-2-yl]deca-5,8-dienoate.
| Compound Name | [(2R)-3-decanoyloxy-2-hydroxypropyl] (5Z,8Z)-10-[3-[(Z)-oct-2-enyl]oxiran-2-yl]deca-5,8-dienoate |
|---|---|
| PubChem CID | 157002510 |
| Molecular Formula | C33H56O6 |
| Molecular Weight | 548.81 g/mol |
| Exact Mass | 548.41 |
| IUPAC Name | [(2R)-3-decanoyloxy-2-hydroxypropyl] (5Z,8Z)-10-[3-[(Z)-oct-2-enyl]oxiran-2-yl]deca-5,8-dienoate |
| SMILES | CCCCC/C=C\CC1OC1C/C=C\C/C=C\CCCC(=O)OC[C@H](O)COC(=O)CCCCCCCCC |
| InChI | InChI=1S/C33H56O6/c1-3-5-7-9-12-17-21-25-32(35)37-27-29(34)28-38-33(36)26-22-18-14-11-13-16-20-24-31-30(39-31)23-19-15-10-8-6-4-2/h11,14-16,19-20,29-31,34H,3-10,12-13,17-18,21-28H2,1-2H3/b14-11-,19-15-,20-16-/t29-,30?,31?/m1/s1 |
| InChIKey | MZUPYIQUEVCZPZ-YFMBPVJYSA-N |
| XLogP | 7.93 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.81 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|