C36H62O6 — CID 157005384
[(2R)-2-hydroxy-3-[4-[3-[(2Z,5Z,8Z)-tetradeca-2,5,8-trienyl]oxiran-2-yl]butanoyloxy]propyl] 10-methyldodecanoate (PubChem CID 157005384) has the molecular formula C36H62O6 and a molecular weight of 590.89 g/mol. Its IUPAC name is [(2R)-2-hydroxy-3-[4-[3-[(2Z,5Z,8Z)-tetradeca-2,5,8-trienyl]oxiran-2-yl]butanoyloxy]propyl] 10-methyldodecanoate.
| Compound Name | [(2R)-2-hydroxy-3-[4-[3-[(2Z,5Z,8Z)-tetradeca-2,5,8-trienyl]oxiran-2-yl]butanoyloxy]propyl] 10-methyldodecanoate |
|---|---|
| PubChem CID | 157005384 |
| Molecular Formula | C36H62O6 |
| Molecular Weight | 590.89 g/mol |
| Exact Mass | 590.45 |
| IUPAC Name | [(2R)-2-hydroxy-3-[4-[3-[(2Z,5Z,8Z)-tetradeca-2,5,8-trienyl]oxiran-2-yl]butanoyloxy]propyl] 10-methyldodecanoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CC1OC1CCCC(=O)OC[C@H](O)COC(=O)CCCCCCCCC(C)CC |
| InChI | InChI=1S/C36H62O6/c1-4-6-7-8-9-10-11-12-13-14-18-21-25-33-34(42-33)26-23-28-36(39)41-30-32(37)29-40-35(38)27-22-19-16-15-17-20-24-31(3)5-2/h9-10,12-13,18,21,31-34,37H,4-8,11,14-17,19-20,22-30H2,1-3H3/b10-9-,13-12-,21-18-/t31?,32-,33?,34?/m1/s1 |
| InChIKey | FARZPCWZHWHMHS-OAEDYKOXSA-N |
| XLogP | 8.96 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.89 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|