C18H32O4 — CID 140991334
8-[3-[(Z)-oct-2-enyl]oxiran-2-yl]octaneperoxoic acid (PubChem CID 140991334) has the molecular formula C18H32O4 and a molecular weight of 312.45 g/mol. Its IUPAC name is 8-[3-[(Z)-oct-2-enyl]oxiran-2-yl]octaneperoxoic acid.
| Compound Name | 8-[3-[(Z)-oct-2-enyl]oxiran-2-yl]octaneperoxoic acid |
|---|---|
| PubChem CID | 140991334 |
| Molecular Formula | C18H32O4 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | 8-[3-[(Z)-oct-2-enyl]oxiran-2-yl]octaneperoxoic acid |
| SMILES | CCCCC/C=C\CC1OC1CCCCCCCC(=O)OO |
| InChI | InChI=1S/C18H32O4/c1-2-3-4-5-7-10-13-16-17(21-16)14-11-8-6-9-12-15-18(19)22-20/h7,10,16-17,20H,2-6,8-9,11-15H2,1H3/b10-7- |
| InChIKey | VEVAGAMQHJVVCO-YFHOEESVSA-N |
| XLogP | 5.03 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|