C22H38O5 — CID 177266056
1,3-dioxan-5-yl 8-[3-[(Z)-oct-2-enyl]oxiran-2-yl]octanoate (PubChem CID 177266056) has the molecular formula C22H38O5 and a molecular weight of 382.54 g/mol. Its IUPAC name is 1,3-dioxan-5-yl 8-[3-[(Z)-oct-2-enyl]oxiran-2-yl]octanoate.
| Compound Name | 1,3-dioxan-5-yl 8-[3-[(Z)-oct-2-enyl]oxiran-2-yl]octanoate |
|---|---|
| PubChem CID | 177266056 |
| Molecular Formula | C22H38O5 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | 1,3-dioxan-5-yl 8-[3-[(Z)-oct-2-enyl]oxiran-2-yl]octanoate |
| SMILES | CCCCC/C=C\CC1OC1CCCCCCCC(=O)OC1COCOC1 |
| InChI | InChI=1S/C22H38O5/c1-2-3-4-5-7-10-13-20-21(27-20)14-11-8-6-9-12-15-22(23)26-19-16-24-18-25-17-19/h7,10,19-21H,2-6,8-9,11-18H2,1H3/b10-7- |
| InChIKey | BFMDSMPCXXMWNP-YFHOEESVSA-N |
| XLogP | 4.93 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|