C18H30O4 — CID 87187815
8-(3-oct-2-enyloxiran-2-yl)-2-oxooctanoic acid (PubChem CID 87187815) has the molecular formula C18H30O4 and a molecular weight of 310.43 g/mol. Its IUPAC name is 8-(3-oct-2-enyloxiran-2-yl)-2-oxooctanoic acid.
| Compound Name | 8-(3-oct-2-enyloxiran-2-yl)-2-oxooctanoic acid |
|---|---|
| PubChem CID | 87187815 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | 8-(3-oct-2-enyloxiran-2-yl)-2-oxooctanoic acid |
| SMILES | CCCCCC=CCC1OC1CCCCCCC(=O)C(=O)O |
| InChI | InChI=1S/C18H30O4/c1-2-3-4-5-6-10-13-16-17(22-16)14-11-8-7-9-12-15(19)18(20)21/h6,10,16-17H,2-5,7-9,11-14H2,1H3,(H,20,21) |
| InChIKey | QMOQGMLEURZGSI-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 66.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|