C20H36N2O3 — CID 87986994
N-(2-amino-2-oxoethyl)-11-(3-pentyloxiran-2-yl)undec-9-enamide (PubChem CID 87986994) has the molecular formula C20H36N2O3 and a molecular weight of 352.52 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-11-(3-pentyloxiran-2-yl)undec-9-enamide.
| Compound Name | N-(2-amino-2-oxoethyl)-11-(3-pentyloxiran-2-yl)undec-9-enamide |
|---|---|
| PubChem CID | 87986994 |
| Molecular Formula | C20H36N2O3 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.27 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-11-(3-pentyloxiran-2-yl)undec-9-enamide |
| SMILES | CCCCCC1OC1CC=CCCCCCCCC(=O)NCC(N)=O |
| InChI | InChI=1S/C20H36N2O3/c1-2-3-10-13-17-18(25-17)14-11-8-6-4-5-7-9-12-15-20(24)22-16-19(21)23/h8,11,17-18H,2-7,9-10,12-16H2,1H3,(H2,21,23)(H,22,24) |
| InChIKey | UQCRAQNCRSAZMU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 84.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|