C42H78N3O4+ — CID 10169659
dimethyl-bis[2-[[(E)-11-(3-pentyloxiran-2-yl)undec-9-enoyl]amino]ethyl]azanium (PubChem CID 10169659) has the molecular formula C42H78N3O4+ and a molecular weight of 689.10 g/mol. Its IUPAC name is dimethyl-bis[2-[[(E)-11-(3-pentyloxiran-2-yl)undec-9-enoyl]amino]ethyl]azanium.
| Compound Name | dimethyl-bis[2-[[(E)-11-(3-pentyloxiran-2-yl)undec-9-enoyl]amino]ethyl]azanium |
|---|---|
| PubChem CID | 10169659 |
| Molecular Formula | C42H78N3O4+ |
| Molecular Weight | 689.10 g/mol |
| Exact Mass | 688.60 |
| IUPAC Name | dimethyl-bis[2-[[(E)-11-(3-pentyloxiran-2-yl)undec-9-enoyl]amino]ethyl]azanium |
| SMILES | CCCCCC1OC1C/C=C/CCCCCCCC(=O)NCC[N+](C)(C)CCNC(=O)CCCCCCC/C=C/CC1OC1CCCCC |
| InChI | InChI=1S/C42H77N3O4/c1-5-7-21-27-37-39(48-37)29-23-17-13-9-11-15-19-25-31-41(46)43-33-35-45(3,4)36-34-44-42(47)32-26-20-16-12-10-14-18-24-30-40-38(49-40)28-22-8-6-2/h17-18,23-24,37-40H,5-16,19-22,25-36H2,1-4H3,(H-,43,44,46,47)/p+1/b23-17+,24-18+ |
| InChIKey | CEHGMQIPHSFXBW-GJHDBBOXSA-O |
| XLogP | 9.34 |
| TPSA | 83.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.10 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|